| Melting point |
203-2060C |
| Boiling point |
513℃ |
| Density |
1.3936 (rough estimate) |
| refractive index |
1.6200 (estimate) |
| Flash point |
>110°(230°F) |
| storage temp. |
Keep in dark place,Inert atmosphere,2-8°C |
| solubility |
methanol: soluble10mg/mL |
| pka |
pKa 5.94 (Uncertain) |
| form |
powder |
| color |
white to white with yellow cast |
| Water Solubility |
Soluble in water at 10mg/ml with warming. Also soluble in ethanol or methanol |
| BRN |
621128 |
| InChI |
InChI=1S/C11H12N4O3S/c1-18-11-6-10(13-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,14,15) |
| InChIKey |
WMPXPUYPYQKQCX-UHFFFAOYSA-N |
| SMILES |
C1(S(NC2C=C(OC)N=CN=2)(=O)=O)=CC=C(N)C=C1 |
| CAS DataBase Reference |
1220-83-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Sulfamonomethoxine (1220-83-3) |
