Sulfamonomethoxine
- Product NameSulfamonomethoxine
- CAS1220-83-3
- CBNumberCB8764126
- MFC11H12N4O3S
- MW280.3
- EINECS624-483-8
- MDL NumberMFCD00063466
- MOL File1220-83-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 203-2060C |
| Boiling point | 513℃ |
| Density | 1.3936 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| Flash point | >110°(230°F) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | methanol: soluble10mg/mL |
| pka | pKa 5.94 (Uncertain) |
| form | powder |
| color | white to white with yellow cast |
| Water Solubility | Soluble in water at 10mg/ml with warming. Also soluble in ethanol or methanol |
| BRN | 621128 |
| InChI | InChI=1S/C11H12N4O3S/c1-18-11-6-10(13-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,14,15) |
| InChIKey | WMPXPUYPYQKQCX-UHFFFAOYSA-N |
| SMILES | C1(S(NC2C=C(OC)N=CN=2)(=O)=O)=CC=C(N)C=C1 |
| CAS DataBase Reference | 1220-83-3(CAS DataBase Reference) |
| FDA UNII | U700P169W2 |
| EPA Substance Registry System | Sulfamonomethoxine (1220-83-3) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H317-H319-H335 | |||||||||
| Precautionary statements | P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38-43 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | WP0550000 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29350090 | |||||||||
| Toxicity | LD50 oral in rabbit: > 10gm/kg | |||||||||
| NFPA 704: |
|
