1220-83-3
| Name | Sulfamonomethoxine |
| CAS | 1220-83-3 |
| EINECS(EC#) | 624-483-8 |
| Molecular Formula | C11H12N4O3S |
| MDL Number | MFCD00063466 |
| Molecular Weight | 280.3 |
| MOL File | 1220-83-3.mol |
Chemical Properties
| Appearance | White To Off-White Crystalline Powder |
| Melting point | 203-2060C |
| Boiling point | 513℃ |
| density | 1.3936 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| Fp | >110°(230°F) |
| storage temp. | 0-6°C |
| solubility | methanol: soluble10mg/mL |
| form | powder |
| pka | pKa 5.94 (Uncertain) |
| color | white to white with yellow cast |
| Water Solubility | Soluble in water at 10mg/ml with warming. Also soluble in ethanol or methanol |
| Usage | Protein binding. Inhibitor of enzyme |
| BRN | 621128 |
| Major Application | clinical testing |
| InChI | InChI=1S/C11H12N4O3S/c1-18-11-6-10(13-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,14,15) |
| InChIKey | WMPXPUYPYQKQCX-UHFFFAOYSA-N |
| SMILES | C1(S(NC2C=C(OC)N=CN=2)(=O)=O)=CC=C(N)C=C1 |
| CAS DataBase Reference | 1220-83-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | WP0550000 |
| HazardClass | IRRITANT |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Toxicity |