2,6-Difluorobenzyl alcohol
- Product Name2,6-Difluorobenzyl alcohol
- CAS19064-18-7
- MFC7H6F2O
- MW144.12
- EINECS242-792-2
- MOL File19064-18-7.mol
Chemical Properties
| Melting point | 168.5-169 °C |
| Boiling point | 88 °C |
| Density | 1.3 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 192 °F |
| storage temp. | 2-8°C |
| pka | 13.41±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.300 |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 2501536 |
| InChI | InChI=1S/C7H6F2O/c8-6-2-1-3-7(9)5(6)4-10/h1-3,10H,4H2 |
| InChIKey | LVICICZQETYOGS-UHFFFAOYSA-N |
| SMILES | C1(CO)=C(F)C=CC=C1F |
| CAS DataBase Reference | 19064-18-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Difluorobenzyl alcohol(19064-18-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| HS Code | 2906290090 |
