1,3,5-Trimethylpyrazole
- Product Name1,3,5-Trimethylpyrazole
- CAS1072-91-9
- MFC6H10N2
- MW110.16
- EINECS626-960-6
- MOL File1072-91-9.mol
Chemical Properties
| Melting point | 38-41 °C (lit.) |
| Boiling point | 168-170 °C |
| Density | 0.93 |
| refractive index | 1.4589 |
| Flash point | 93 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | 3.30±0.10(Predicted) |
| color | White or Colorless to Light yellow |
| λmax | 220nm(MeOH)(lit.) |
| BRN | 110515 |
| InChI | InChI=1S/C6H10N2/c1-5-4-6(2)8(3)7-5/h4H,1-3H3 |
| InChIKey | HNOQAFMOBRWDKQ-UHFFFAOYSA-N |
| SMILES | N1(C)C(C)=CC(C)=N1 |
| CAS DataBase Reference | 1072-91-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,5-Trimethylpyrazole(1072-91-9) |
Safety Information
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1325 4.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29331990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |
