Stannous sulfate
- Product NameStannous sulfate
- CAS7488-55-3
- MFO4SSn
- MW214.77
- EINECS231-302-2
- MOL File7488-55-3.mol
Chemical Properties
| Melting point | 360 °C |
| bulk density | 800kg/m3 |
| Density | 4,15 g/cm3 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | no restrictions. |
| form | Solid |
| Specific Gravity | 1.35 |
| color | White to off-white |
| PH | 1.6 (50g/l, H2O, 20℃) |
| Odor | Odorless |
| Water Solubility | 330 g/L (20 ºC) |
| Merck | 14,8790 |
| Exposure limits | ACGIH: TWA 2 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 2 mg/m3 |
| Stability | Stable, but moisture sensitive. Incompatible with strong oxidizing agents. |
| InChI | 1S/H2O4S.Sn/c1-5(2,3)4;/h(H2,1,2,3,4);/q;+2/p-2 |
| InChIKey | OBBXFSIWZVFYJR-UHFFFAOYSA-L |
| SMILES | [SnH2++].[O-]S([O-])(=O)=O |
| CAS DataBase Reference | 7488-55-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-36/37-68-50/53-48/22-43-20 |
| Safety Statements | 26-36-39-61-60-45-37-53 |
| WGK Germany | WGK 3 |
| RTECS | WT1255000 |
| TSCA | TSCA listed |
| HS Code | 28332990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Inhalation Aquatic Chronic 1 Eye Irrit. 2 Met. Corr. 1 Muta. 2 Skin Irrit. 2 Skin Sens. 1 STOT RE 2 STOT SE 3 |
| Toxicity | LD50 orally in Rabbit: 2207 mg/kg |