Titanium ethylhexoxide
- Product NameTitanium ethylhexoxide
- CAS1070-10-6
- MFC8H18OTi
- MW178.1
- EINECS213-969-1
- MOL File1070-10-6.mol
Chemical Properties
| Melting point | 18-20°C |
| Boiling point | 248-249 °C/11 mmHg (lit.) |
| Density | 0.927 g/mL at 25 °C (lit.) |
| vapor pressure | 1hPa at 20℃ |
| refractive index | n |
| Flash point | 160 °F |
| form | Liquid |
| Specific Gravity | 0.927 |
| color | Pale yellow |
| Water Solubility | 880-1379mg/L at 25℃ |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 3692023 |
| Stability | Stable. Incompatible with bases, acids, strong oxidizing agents. Combustible. Moisture sensitive - store under nitrogen. |
| InChI | 1S/4C8H17O.Ti/c4*1-3-5-6-8(4-2)7-9;/h4*8H,3-7H2,1-2H3;/q4*-1;+4 |
| InChIKey | KTXWGMUMDPYXNN-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CO[Ti](OCC(CC)CCCC)(OCC(CC)CCCC)OCC(CC)CCCC |
| LogP | 2.9-2.95 at 20-25℃ |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG III |
| WGK Germany | 2 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
