2-Butyl-1-octanol
- Product Name2-Butyl-1-octanol
- CAS3913-02-8
- MFC12H26O
- MW186.33
- EINECS223-470-0
- MOL File3913-02-8.mol
Chemical Properties
| Melting point | -80°C(lit.) |
| Boiling point | 145-149 °C(lit.) |
| Density | 0.833 g/mL at 25 °C(lit.) |
| vapor pressure | 8.1Pa at 37.8℃ |
| refractive index | 1.4400 to 1.4440 |
| Flash point | 113 °C |
| storage temp. | Store at room temperature |
| pka | 15.09±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | 1mg/L at 23℃ |
| Stability | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Cosmetics Ingredients Functions | HUMECTANT SOLVENT |
| InChI | InChI=1S/C12H26O/c1-3-5-7-8-10-12(11-13)9-6-4-2/h12-13H,3-11H2,1-2H3 |
| InChIKey | XMVBHZBLHNOQON-UHFFFAOYSA-N |
| SMILES | C(O)C(CCCC)CCCCCC |
| LogP | 5.5 at 23℃ |
| EPA Substance Registry System | 2-Butyloctanol (3913-02-8) |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50-50/53 |
| Safety Statements | 57-61 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 2 |
| RTECS | RH0885000 |
| TSCA | TSCA listed |
| HS Code | 2905.19.9090 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
