2-Chloro-6-methylnicotinic acid
- Product Name2-Chloro-6-methylnicotinic acid
- CAS30529-70-5
- MFC7H6ClNO2
- MW171.58
- EINECS250-229-7
- MOL File30529-70-5.mol
Chemical Properties
| Melting point | 162-164 °C (lit.) |
| Boiling point | 163 °C / 22mmHg |
| Density | 1.3246 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 2.28±0.28(Predicted) |
| form | Crystalline Powder |
| color | White to yellow to beige |
| BRN | 473070 |
| InChI | InChI=1S/C7H6ClNO2/c1-4-2-3-5(7(10)11)6(8)9-4/h2-3H,1H3,(H,10,11) |
| InChIKey | ACQXHCHKMFYDPM-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C)=CC=C1C(O)=O |
| CAS DataBase Reference | 30529-70-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |