| Melting point |
210-213 °C (lit.) |
| Boiling point |
251.96°C (rough estimate) |
| Density |
1.2528 (rough estimate) |
| refractive index |
1.5030 (estimate) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
DMSO (Slightly), Methanol (Slightly) |
| form |
Powder, Crystals and/or Chunks |
| pka |
2.37±0.10(Predicted) |
| color |
White to light yellow to beige |
| Water Solubility |
Sparingly soluble in water. |
| BRN |
112049 |
| InChI |
InChI=1S/C7H7NO2/c1-5-2-3-6(4-8-5)7(9)10/h2-4H,1H3,(H,9,10) |
| InChIKey |
RZOKQIPOABEQAM-UHFFFAOYSA-N |
| SMILES |
C1=NC(C)=CC=C1C(O)=O |
| CAS DataBase Reference |
3222-47-7(CAS DataBase Reference) |
