4-Methylthiophenylacetic acid
- Product Name4-Methylthiophenylacetic acid
- CAS16188-55-9
- MFC9H10O2S
- MW182.24
- EINECS
- MOL File16188-55-9.mol
Chemical Properties
| Melting point | 97-98 °C(lit.) |
| Boiling point | 337.4±25.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.34±0.10(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C9H10O2S/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | AHMLFHMRRBJCRM-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(SC)C=C1 |
| CAS DataBase Reference | 16188-55-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29309099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |