4-(Trifluoromethylthio)phenol
- Product Name4-(Trifluoromethylthio)phenol
- CAS461-84-7
- MFC7H5F3OS
- MW194.17
- EINECS620-583-0
- MOL File461-84-7.mol
Chemical Properties
| Melting point | 57-60 °C (lit.) |
| Boiling point | 77-78 °C/7 mmHg (lit.) |
| Density | 1.45 |
| Flash point | 57°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.53±0.13(Predicted) |
| color | White to Almost white |
| Sensitive | Stench |
| InChI | InChI=1S/C7H5F3OS/c8-7(9,10)12-6-3-1-5(11)2-4-6/h1-4,11H |
| InChIKey | YYCPTWHVKSATQK-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(SC(F)(F)F)C=C1 |
| CAS DataBase Reference | 461-84-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT, STENCH |
| HS Code | 2930909899 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |