Benzenesulfonic acid sodium salt
- Product NameBenzenesulfonic acid sodium salt
- CAS515-42-4
- MFC6H7NaO3S
- MW182.17
- EINECS208-198-2
- MOL File515-42-4.mol
Chemical Properties
| Melting point | 450 °C |
| Density | 1.124 g/mL at 25 °C (lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble |
| form | Crystalline Powder |
| color | White to off-white |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| Merck | 14,1070 |
| BRN | 3918459 |
| Stability | Stable. Hygroscopic. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C6H6O3S.Na.H/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H,7,8,9);; |
| InChIKey | MZSDGDXXBZSFTG-UHFFFAOYSA-M |
| SMILES | S(C1C=CC=CC=1)(O)(=O)=O.[NaH] |
| CAS DataBase Reference | 515-42-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonic acid, sodium salt (515-42-4) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-24/25-22 |
| WGK Germany | 3 |
| RTECS | DB7350000 |
| TSCA | TSCA listed |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 515-42-4(Hazardous Substances Data) |
