Chemical Properties
| Melting point | 255 °C (dec.)(lit.) |
| Density | 0.991 g/mL at 25 °C |
| storage temp. | Store at RT. |
| solubility | H2O: soluble |
| pka | 6.3, 6.12(at 25℃) |
| form | Powder |
| color | Red-brown |
| PH | 5.2-6.8, yellow-green to purple |
| PH Range | Yellow (5.2) to purple (6.8) |
| Water Solubility | soluble |
| λmax | 585nm, 379nm |
| ε(extinction coefficient) | ≥60000 at 584-590nm in 10 mM NaOH |
| Major Application | Study properties of silicon dioxide films |
| InChI | 1S/C21H16Br2O5S.Na/c1-11-7-13(9-16(22)19(11)24)21(14-8-12(2)20(25)17(23)10-14)15-5-3-4-6-18(15)29(26,27)28-21;/h3-10,24-25H,1-2H3;/q;+1/p-1 |
| InChIKey | WNOIORUCCYNQPE-UHFFFAOYSA-M |
| SMILES | [Na+].Cc1cc(cc(Br)c1O)C2(OS(=O)(=O)c3ccccc23)c4cc(C)c([O-])c(Br)c4 |
| CAS DataBase Reference | 62625-30-3(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2-bromo-6-methyl-, monosodium salt (62625-30-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37-24/25-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
