| Melting point |
250 °C (dec.)(lit.) |
| storage temp. |
Store at RT. |
| solubility |
Solubility Soluble in water, ethanol |
| form |
Powder |
| pka |
1.0(at 25℃) |
| color |
Brown |
| PH Range |
0.2 (red) - 1.8 (yellow) and 7.2 (yellow) - 8.8 (red) |
| Water Solubility |
SOLUBLE |
| λmax |
425nm |
| Major Application |
Thermochromic materials, cosmetics, measurement of hydrophobicity of
therapeutic drugs |
| InChI |
InChI=1S/C21H18O5S.Na.H/c1-13-11-15(7-9-18(13)22)21(16-8-10-19(23)14(2)12-16)17-5-3-4-6-20(17)27(24,25)26-21;;/h3-12,22-23H,1-2H3;; |
| InChIKey |
OUMMIBMDWMSXKF-UHFFFAOYSA-N |
| SMILES |
O=S1(C2C=CC=CC=2C(C2C=CC(O)=C(C)C=2)(C2C=CC(O)=C(C)C=2)O1)=O.[NaH] |
| CAS DataBase Reference |
62625-29-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Cresol red sodium salt (62625-29-0) |
