Cresol Red sodium salt
- Product NameCresol Red sodium salt
- CAS62625-29-0
- CBNumberCB1376562
- MFC21H19NaO5S
- MW406.43
- EINECS263-654-8
- MDL NumberMFCD00001618
- MOL File62625-29-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 250 °C (dec.)(lit.) |
| storage temp. | Store at RT. |
| solubility | Solubility Soluble in water, ethanol |
| form | Powder |
| pka | 1.0(at 25℃) |
| color | Brown |
| PH Range | 0.2 (red) - 1.8 (yellow) and 7.2 (yellow) - 8.8 (red) |
| Water Solubility | SOLUBLE |
| λmax | 425nm |
| Major Application | Thermochromic materials, cosmetics, measurement of hydrophobicity of therapeutic drugs |
| InChI | InChI=1S/C21H18O5S.Na.H/c1-13-11-15(7-9-18(13)22)21(16-8-10-19(23)14(2)12-16)17-5-3-4-6-20(17)27(24,25)26-21;;/h3-12,22-23H,1-2H3;; |
| InChIKey | OUMMIBMDWMSXKF-UHFFFAOYSA-N |
| SMILES | O=S1(C2C=CC=CC=2C(C2C=CC(O)=C(C)C=2)(C2C=CC(O)=C(C)C=2)O1)=O.[NaH] |
| CAS DataBase Reference | 62625-29-0(CAS DataBase Reference) |
| FDA UNII | 839K2R4B8K |
| EPA Substance Registry System | Cresol red sodium salt (62625-29-0) |
| UNSPSC Code | 12171500 |
| NACRES | NA.47 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 22-24/25-36-26 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29147000 | |||||||||
| NFPA 704: |
|
