| Melting point |
290 °C |
| Boiling point |
479.59°C (rough estimate) |
| bulk density |
600-620kg/m3 |
| Density |
0.998 g/cm3 |
| refractive index |
1.5300 (estimate) |
| storage temp. |
Store at +5°C to +30°C. |
| solubility |
Solubility Sparingly soluble in water; soluble in ethanol |
| form |
Powder |
| pka |
1.0(at 25℃) |
| color |
Dark green or brown-red |
| PH Range |
7.2(YELLOW)--8.8(PURPLISH RED) |
| PH |
7.2~8.8 |
| Water Solubility |
soluble |
| λmax |
570nm, 367nm, 432nm |
| Merck |
14,2578 |
| BRN |
343399 |
| Major Application |
Display device, optical sensors, combustion gas detection system, inks, correction fluid, diapers, toothpaste, identifying fresh and stale rice, food storage, determine glucose in dialysis solution, monitor metabolic activity of microorganisms, detect bacterialinfection, psychoactive drugs, dental impression material |
| InChI |
1S/C21H18O5S/c1-13-11-15(7-9-18(13)22)21(16-8-10-19(23)14(2)12-16)17-5-3-4-6-20(17)27(24,25)26-21/h3-12,22-23H,1-2H3 |
| InChIKey |
ASMGMVUGPNODGX-UHFFFAOYSA-N |
| SMILES |
Cc1cc(ccc1O)C2(OS(=O)(=O)c3ccccc23)c4ccc(O)c(C)c4 |
| EPA Substance Registry System |
Cresol Red (1733-12-6) |