1-Butyl-3-methylimidazolium thiocyanate
- Product Name1-Butyl-3-methylimidazolium thiocyanate
- CAS344790-87-0
- MFC9H15N3S
- MW197.3
- EINECS200-145-6
- MOL File344790-87-0.mol
Chemical Properties
| Melting point | -28.63 °C |
| Density | 1.07 g/mL at 25 °C |
| refractive index | n20/D1.538 |
| Flash point | 207 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| color | Light yellow to Yellow to Orange |
| Major Application | battery manufacturing |
| InChI | 1S/C8H15N2.CHNS/c1-3-4-5-10-7-6-9(2)8-10;2-1-3/h6-8H,3-5H2,1-2H3;3H/q+1;/p-1 |
| InChIKey | SIXHYMZEOJSYQH-UHFFFAOYSA-M |
| SMILES | [S-]C#N.CCCCn1cc[n+](C)c1 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-32-52/53 |
| Safety Statements | 13-61-46-36/37 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 2 |
| F | 3-10 |
| HS Code | 29332900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 3 |