1-Butyl-3-methylimidazolium hydrogensulfate
- Product Name1-Butyl-3-methylimidazolium hydrogensulfate
- CAS262297-13-2
- MFC8H16N2O4S
- MW236.29
- EINECS200-145-6
- MOL File262297-13-2.mol
Chemical Properties
| Melting point | 29-32 °C |
| Density | 1.27g/ml |
| Flash point | 284 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | clear liquid |
| color | Colorless to Red to Green |
| InChI | 1S/C8H15N2.H2O4S/c1-3-4-5-10-7-6-9(2)8-10;1-5(2,3)4/h6-8H,3-5H2,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | KXCVJPJCRAEILX-UHFFFAOYSA-M |
| SMILES | OS([O-])(=O)=O.CCCCn1cc[n+](C)c1 |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 2933.29.9000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |