1-Butyl-3-methylimidazolium tetrafluoroborate
- Product Name1-Butyl-3-methylimidazolium tetrafluoroborate
- CAS174501-65-6
- MFC8H15BF4N2
- MW226.02
- EINECS638-831-1
- MOL File174501-65-6.mol
Chemical Properties
| Melting point | -71 °C |
| Density | 1.21 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point | 288 °C |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Viscous Liquid |
| color | Clear yellow-orange |
| PH | 5 (H2O, 20℃) |
| Water Solubility | Miscible with acetone, acetonitrile, ethyl acetate, isopropyl alcohol and methylene chloride. Immiscible with hexane, toluene and water. |
| Stability | hygroscopic |
| InChI | InChI=1S/C8H15N2.BF4/c1-3-4-5-10-7-6-9(2)8-10;2-1(3,4)5/h6-8H,3-5H2,1-2H3;/q+1;-1 |
| InChIKey | YKVHBSVCYVBXQM-UHFFFAOYSA-M |
| SMILES | N1(CCCC)C=C[N+](C)=C1.[B-](F)(F)(F)F |
| CAS DataBase Reference | 174501-65-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi,N,T |
| Risk Statements | 22-36/37/38-51/53-36/38-25 |
| Safety Statements | 37/39-26-61-45 |
| RIDADR | UN2810 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2933 29 90 |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 |