| Melting point |
~70 °C |
| Density |
d25 1.08 (dried) |
| Flash point |
192 °C |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
DMSO (Slightly), Methanol (Sparingly) |
| form |
Mass |
| color |
Cream to yellow |
| Water Solubility |
Soluble in acetone, acetonitrile, hot ethyl acetate, isopropyl alcohol, methylene chloride and methanol. Insoluble in water, hexane and toluene, |
| Sensitive |
Hygroscopic |
| BRN |
6449277 |
| Stability |
hygroscopic |
| InChI |
InChI=1S/C8H15N2.ClH/c1-3-4-5-10-7-6-9(2)8-10;/h6-8H,3-5H2,1-2H3;1H/q+1;/p-1 |
| InChIKey |
FHDQNOXQSTVAIC-UHFFFAOYSA-M |
| SMILES |
N1(CCCC)C=C[N+](C)=C1.[Cl-] |
| CAS DataBase Reference |
79917-90-1(CAS DataBase Reference) |
| EPA Substance Registry System |
1H-Imidazolium, 3-butyl-1-methyl-, chloride (1:1) (79917-90-1) |
