1-Butyl-3-methylimidazolium chloride
- Product Name1-Butyl-3-methylimidazolium chloride
- CAS79917-90-1
- MFC8H15ClN2
- MW174.67
- EINECS460-120-8
- MOL File79917-90-1.mol
Chemical Properties
| Melting point | ~70 °C |
| Density | d25 1.08 (dried) |
| Flash point | 192 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| form | Mass |
| color | Cream to yellow |
| Water Solubility | Soluble in acetone, acetonitrile, hot ethyl acetate, isopropyl alcohol, methylene chloride and methanol. Insoluble in water, hexane and toluene, |
| Sensitive | Hygroscopic |
| BRN | 6449277 |
| Stability | hygroscopic |
| Major Application | battery manufacturing |
| InChI | InChI=1S/C8H15N2.ClH/c1-3-4-5-10-7-6-9(2)8-10;/h6-8H,3-5H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | FHDQNOXQSTVAIC-UHFFFAOYSA-M |
| SMILES | N1(CCCC)C=C[N+](C)=C1.[Cl-] |
| CAS DataBase Reference | 79917-90-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Imidazolium, 3-butyl-1-methyl-, chloride (1:1) (79917-90-1) |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 25-36/37/38-51/53-36/38 |
| Safety Statements | 26-45-61-22 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 |