1-Butyl-3-methylimidazolium trifluoromethansulfonate
- Product Name1-Butyl-3-methylimidazolium trifluoromethansulfonate
- CAS174899-66-2
- MFC9H15F3N2O3S
- MW288.29
- EINECS200-145-6
- MOL File174899-66-2.mol
Chemical Properties
| Melting point | 16°C |
| Density | 1.292 g/mL at 20 °C(lit.) |
| refractive index | 1.434 |
| Flash point | >100°C |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless to Yellow to Green |
| PH | 7-8 (200g/l, H2O, 20℃) |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C8H15N2.CHF3O3S/c1-3-4-5-10-7-6-9(2)8-10;2-1(3,4)8(5,6)7/h6-8H,3-5H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | FRZPYEHDSAQGAS-UHFFFAOYSA-M |
| SMILES | N1(CCCC)C=C[N+](C)=C1.C(F)(F)(F)S([O-])(=O)=O |
| CAS DataBase Reference | 174899-66-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi,N,T |
| Risk Statements | 36/37/38-21/22-51/53-36/38-25-23/24/25 |
| Safety Statements | 36/37/39-26-61-45-36-22 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| HS Code | 2933 29 90 |
| Storage Class | 10 - Combustible liquids |
