1-Ethyl-3-methylimidazolium thiocyanate
- Product Name1-Ethyl-3-methylimidazolium thiocyanate
- CAS331717-63-6
- MFC6H11N2.CNS
- MW169.25
- EINECS200-145-6
- MOL File331717-63-6.mol
Chemical Properties
| Melting point | -6℃ |
| Density | 1.14 |
| refractive index | n20/D 1.553 |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C6H11N2.CHNS/c1-3-8-5-4-7(2)6-8;2-1-3/h4-6H,3H2,1-2H3;3H/q+1;/p-1 |
| InChIKey | VASPYXGQVWPGAB-UHFFFAOYSA-M |
| SMILES | [N+]1(=CN(C=C1)CC)C.C([S-])#N |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-32-52/53-52 |
| Safety Statements | 13-61 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 2 |
| F | 3-10 |
| HS Code | 2933 29 90 |
| HazardClass | 6.1 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
