1-Ethyl-3-methylimidazolium methylsulfate
- Product Name1-Ethyl-3-methylimidazolium methylsulfate
- CAS516474-01-4
- MFC7H14N2O4S
- MW222.26
- EINECS200-100-5
- MOL File516474-01-4.mol
Chemical Properties
| Density | 1.28 g/cm3 (26 °C) |
| refractive index | 1.4780 to 1.4820 |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C6H11N2.CH4O4S/c1-3-8-5-4-7(2)6-8;1-5-6(2,3)4/h4-6H,3H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | BXSDLSWVIAITRQ-UHFFFAOYSA-M |
| SMILES | COS([O-])(=O)=O.CCn1cc[n+](C)c1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2933.29.9000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B STOT SE 3 |