| Melting point |
-12°C |
| Boiling point |
>350 °C (lit.) |
| Density |
1.387 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.435(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Store below +30°C. |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| Water Solubility |
Soluble in water. |
| InChI |
InChI=1S/C6H11N2.CHF3O3S/c1-3-8-5-4-7(2)6-8;2-1(3,4)8(5,6)7/h4-6H,3H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey |
ZPTRYWVRCNOTAS-UHFFFAOYSA-M |
| SMILES |
N1(CC)C=C[N+](C)=C1.C(F)(F)(F)S([O-])(=O)=O |
| LogP |
-2.5--2.2 at 23℃ and pH6.8 |
| CAS DataBase Reference |
145022-44-2(CAS DataBase Reference) |
| ECW |
3.9 V |
