1-Butyl-3-methylimidazolium dicyanamide
- Product Name1-Butyl-3-methylimidazolium dicyanamide
- CAS448245-52-1
- MFC10H15N5
- MW205.26
- EINECS200-145-6
- MOL File448245-52-1.mol
Chemical Properties
| Melting point | -6°C(lit.) |
| Density | 1.06 g/cm3 |
| refractive index | 1.5080 to 1.5120 |
| storage temp. | Store at +15°C to +25°C. |
| form | Liquid |
| color | Pale yellow |
| PH | 8 (H2O, 20℃) |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C8H15N2.C2N3/c1-3-4-5-10-7-6-9(2)8-10;3-1-5-2-4/h6-8H,3-5H2,1-2H3;/q+1;-1 |
| InChIKey | ICIVTHOGIQHZRY-UHFFFAOYSA-N |
| SMILES | [N+]1(C=CN(CCCC)C=1)C.C(#N)[N-]C#N |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29332900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
