1-Ethyl-3-methylimidazolium dicyanamide
- Product Name1-Ethyl-3-methylimidazolium dicyanamide
- CAS370865-89-7
- MFC8H11N5
- MW177.21
- EINECS609-330-5
- MOL File370865-89-7.mol
Chemical Properties
| Melting point | 267.75-268.25℃ |
| Density | 1.11 |
| refractive index | 1.5130-1.5170 |
| Flash point | 221°C(lit.) |
| storage temp. | Store below +30°C. |
| form | liquid |
| color | Light yellow to Brown |
| Water Solubility | Soluble in water. Soluble in solvents like methanol, acetone. |
| InChI | InChI=1S/C6H11N2.C2N3/c1-3-8-5-4-7(2)6-8;3-1-5-2-4/h4-6H,3H2,1-2H3;/q+1;-1 |
| InChIKey | MKHFCTXNDRMIDR-UHFFFAOYSA-N |
| SMILES | [N+]1(C=CN(CC)C=1)C.C(#N)[N-]C#N |
| LogP | -2.4--2.3 at 23℃ and pH6.8 |
| CAS DataBase Reference | 370865-89-7 |
| EPA Substance Registry System | 1H-Imidazolium, 3-ethyl-1-methyl-, salt with N-cyanocyanamide (1:1) (370865-89-7) |
| ECW | 3.0 V |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Skin Sens. 1B |
