1-Methylpiperidin-4-amine
- Product Name1-Methylpiperidin-4-amine
- CAS41838-46-4
- MFC6H14N2
- MW114.19
- EINECS628-217-1
- MOL File41838-46-4.mol
Chemical Properties
| Melting point | 203-207 |
| Boiling point | 62-64°C 1mm |
| Density | 0.91 |
| refractive index | 1.4700-1.4740 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 9.92±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C6H14N2/c1-8-4-2-6(7)3-5-8/h6H,2-5,7H2,1H3 |
| InChIKey | ALOCUZOKRULSAA-UHFFFAOYSA-N |
| SMILES | N1(C)CCC(N)CC1 |
| CAS DataBase Reference | 41838-46-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22-34-11 |
| Safety Statements | 26-36/37/39-45-22-16-9 |
| RIDADR | 2920 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅱ |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |