| Melting point |
33.0 to 37.0 °C |
| Boiling point |
148°C 0,8mm |
| Density |
0.8256 (estimate) |
| refractive index |
1.4390 (estimate) |
| Flash point |
33 °C |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
powder to lump to clear liquid |
| color |
White or Colorless to Light orange to Yellow |
| Henry's Law Constant |
4.7×10-3 mol/(m3Pa) at 25℃, Gharagheizi et al. (2012) |
| InChI |
InChI=1S/C14H28O/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h3-13H2,1-2H3 |
| InChIKey |
POQLVOYRGNFGRM-UHFFFAOYSA-N |
| SMILES |
CC(=O)CCCCCCCCCCCC |
| LogP |
5.563 (est) |
| CAS DataBase Reference |
2345-27-9(CAS DataBase Reference) |
