5-Bromo-2-nitropyridine
- Product Name5-Bromo-2-nitropyridine
- CAS39856-50-3
- MFC5H3BrN2O2
- MW202.99
- EINECS609-748-8
- MOL File39856-50-3.mol
Chemical Properties
| Melting point | 148-150 °C (lit.) |
| Boiling point | 292.3±20.0 °C(Predicted) |
| Density | 1.833±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -4.95±0.22(Predicted) |
| color | White to yellow to beige powder or crystal or chunks |
| BRN | 120878 |
| InChI | InChI=1S/C5H3BrN2O2/c6-4-1-2-5(7-3-4)8(9)10/h1-3H |
| InChIKey | ATXXLNCPVSUCNK-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC=C(Br)C=C1 |
| CAS DataBase Reference | 39856-50-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
