2-Bromo-4-nitropyridine 1-oxide
- Product Name2-Bromo-4-nitropyridine 1-oxide
- CAS52092-43-0
- MFC5H3BrN2O3
- MW218.99
- EINECS661-534-3
- MOL File52092-43-0.mol
Chemical Properties
| Melting point | 143-146°C |
| Boiling point | 430.2±25.0 °C(Predicted) |
| Density | 1.98±0.1 g/cm3(Predicted) |
| pka | -2.53±0.10(Predicted) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 145698 |
| InChI | InChI=1S/C5H3BrN2O3/c6-5-3-4(8(10)11)1-2-7(5)9/h1-3H |
| InChIKey | IRBDHXCXCSFNEQ-UHFFFAOYSA-N |
| SMILES | C1(Br)[N+]([O-])=CC=C([N+]([O-])=O)C=1 |
| CAS DataBase Reference | 52092-43-0(CAS DataBase Reference) |
Safety Information
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 22-26-36/37/39-36 |
| RIDADR | 2811 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
