5-Bromo-2-pyridinecarbonitrile
- Product Name5-Bromo-2-pyridinecarbonitrile
- CAS97483-77-7
- MFC6H3BrN2
- MW183.01
- EINECS628-634-9
- MOL File97483-77-7.mol
Chemical Properties
| Melting point | 128-132 °C (lit.) |
| Boiling point | 100-110 °C/3 mmHg (lit.) |
| Density | 1.72±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in dichloromethane, ether, ethyl acetate and methanol |
| form | powder to crystal |
| pka | -2.68±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 5498624 |
| InChI | InChI=1S/C6H3BrN2/c7-5-1-2-6(3-8)9-4-5/h1-2,4H |
| InChIKey | DMSHUVBQFSNBBL-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=C(Br)C=C1 |
| CAS DataBase Reference | 97483-77-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 22-37/38-41-36/37/38-20/21/22-43 |
| Safety Statements | 26-36/37/39-36/37-9 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
