5-Bromo-2-pyridinecarbonitrile
- Product Name5-Bromo-2-pyridinecarbonitrile
- CAS97483-77-7
- CBNumberCB2402716
- MFC6H3BrN2
- MW183.01
- EINECS628-634-9
- MDL NumberMFCD00234144
- MOL File97483-77-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 128-132 °C (lit.) |
| Boiling point | 100-110 °C/3 mmHg (lit.) |
| Density | 1.72±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in dichloromethane, ether, ethyl acetate and methanol |
| form | powder to crystal |
| pka | -2.68±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 5498624 |
| InChI | InChI=1S/C6H3BrN2/c7-5-1-2-6(3-8)9-4-5/h1-2,4H |
| InChIKey | DMSHUVBQFSNBBL-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=C(Br)C=C1 |
| CAS DataBase Reference | 97483-77-7(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H318-H335 | |||||||||
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 | |||||||||
| Hazard Codes | Xn,T,Xi | |||||||||
| Risk Statements | 22-37/38-41-36/37/38-20/21/22-43 | |||||||||
| Safety Statements | 26-36/37/39-36/37-9 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Harmful | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29339900 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
