2-Bromo-4-nitropyridine
- Product Name2-Bromo-4-nitropyridine
- CAS6945-67-1
- MFC5H3BrN2O2
- MW202.99
- EINECS
- MOL File6945-67-1.mol
Chemical Properties
| Melting point | 64℃ |
| Boiling point | 286.1±20.0 °C(Predicted) |
| Density | 1.833±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -3.12±0.10(Predicted) |
| color | Light yellow to Yellow to Green |
| BRN | 120826 |
| InChI | InChI=1S/C5H3BrN2O2/c6-5-3-4(8(9)10)1-2-7-5/h1-3H |
| InChIKey | AFVITJKRFRRQKT-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 6945-67-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |