N,N'-Dimethyl-1,2-ethanediamine
- Product NameN,N'-Dimethyl-1,2-ethanediamine
- CAS110-70-3
- MFC4H12N2
- MW88.15
- EINECS203-793-3
- MOL File110-70-3.mol
Chemical Properties
| Melting point | 1.63°C (estimate) |
| Boiling point | 119 °C(lit.) |
| Density | 0.819 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | 83 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Miscible with chloroform and dichloromethane. |
| form | Liquid |
| pka | 10.54±0.10(Predicted) |
| color | Clear colorless to slightly yellow |
| Specific Gravity | 0.828 |
| Sensitive | Air Sensitive |
| BRN | 878142 |
| InChIKey | KVKFRMCSXWQSNT-UHFFFAOYSA-N |
| LogP | -0.620 |
| CAS DataBase Reference | 110-70-3(CAS DataBase Reference) |
| NIST Chemistry Reference | CH3NHCH2CH2NHCH3(110-70-3) |
| EPA Substance Registry System | 1,2-Ethanediamine, N,N'-dimethyl- (110-70-3) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 10-34-20/21/22 |
| Safety Statements | 26-36/37/39-45-16 |
| RIDADR | UN 2734 8/PG 2 |
| WGK Germany | 3 |
| RTECS | KV4250000 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29212900 |
| Toxicity | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 17, Pg. 235, 1982. |
