1,2-Dianilinoethane
- Product Name1,2-Dianilinoethane
- CAS150-61-8
- MFC14H16N2
- MW212.29
- EINECS205-765-6
- MOL File150-61-8.mol
Chemical Properties
| Melting point | 65-67 °C(lit.) |
| Boiling point | 228°C 12mm |
| Density | 1.0799 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point | 228°C/12mm |
| storage temp. | 2-8°C, protect from light |
| pka | 4.67±0.50(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light red |
| Water Solubility | Sparingly soluble in water 0.072 g/L @ 25°C. |
| Merck | 14,2990 |
| BRN | 646740 |
| InChI | InChI=1S/C14H16N2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | NOUUUQMKVOUUNR-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=CC=C1)CNC1=CC=CC=C1 |
| CAS DataBase Reference | 150-61-8(CAS DataBase Reference) |
| EPA Substance Registry System | N,N'-Diphenylethylenediamine (150-61-8) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | KV4800000 |
| F | 34 |
| TSCA | TSCA listed |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
