| Melting point |
213-216 °C(lit.) |
| Boiling point |
670.8±55.0 °C(Predicted) |
| Density |
1.48±0.1 g/cm3(Predicted) |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
Solid |
| pka |
1.78±0.10(Predicted) |
| color |
White to off-white |
| Water Solubility |
425.4g/L at 25℃ |
| Stability |
Stable. Incompatible with strong oxidizing agents. Combustible. |
| InChI |
InChI=1/C14H22N2O8/c17-11(18)5-15(6-12(19)20)9-3-1-2-4-10(9)16(7-13(21)22)8-14(23)24/h9-10H,1-8H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)/t9-,10-/s3 |
| InChIKey |
FCKYPQBAHLOOJQ-DPIMBTEZNA-N |
| SMILES |
N([C@@H]1CCCC[C@H]1N(CC(=O)O)CC(=O)O)(CC(=O)O)CC(=O)O |&1:1,6,r| |
| LogP |
-2.15 at 25℃ |
| CAS DataBase Reference |
13291-61-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Glycine, N,N'-(1R,2R)-1,2-cyclohexanediylbis[N-(carboxymethyl)-, rel- (13291-61-7) |
