2-Iodoxybenzoic acid
- Product Name2-Iodoxybenzoic acid
- CAS61717-82-6
- CBNumberCB3194863
- MFC7H5IO4
- MW280.02
- EINECS629-407-7
- MDL NumberMFCD02912492
- MOL File61717-82-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 280 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Very Slightly, Heated) |
| form | powder to crystal |
| color | White to Almost white |
| Merck | 14,5048 |
| InChI | InChI=1S/C7H5IO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10) |
| InChIKey | CQMJEZQEVXQEJB-UHFFFAOYSA-N |
| SMILES | C1(C(=O)O)C=CC=CC=1I(=O)=O |
| CAS DataBase Reference | 61717-82-6(CAS DataBase Reference) |
| FDA UNII | 3K0C43POH0 |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
![]() ![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H335-H372 | |||||||||
| Precautionary statements | P260-P270-P280-P303+P361+P353-P305+P351+P338-P314 | |||||||||
| Hazard Codes | C,Xi,Xn | |||||||||
| Risk Statements | 22-34-44-42/43-36/37/38-20/21/22-37-35-1 | |||||||||
| Safety Statements | 26-36/37/39-45-22-35 | |||||||||
| RIDADR | UN 1759 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | Ⅱ | |||||||||
| HS Code | 29163990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1 STOT RE 1 Inhalation STOT SE 3 | |||||||||
| NFPA 704: |
|

