Dess-Martin periodinane
- Product NameDess-Martin periodinane
- CAS87413-09-0
- CBNumberCB0776475
- MFC13H13IO8
- MW424.14
- EINECS672-328-8
- MDL NumberMFCD00130127
- MOL File87413-09-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 130-133 °C (lit.) |
| Boiling point | 40 °C |
| Density | 1.369 g/mL at 25 °C |
| Flash point | >221 °F |
| storage temp. | -20°C |
| solubility | Soluble in chloroform, acetone, acetonitrile and methylene chloride. Slightly soluble in ether and hexane. |
| form | Liquid |
| color | Colorless to light yellow |
| Sensitive | Light Sensitive |
| Merck | 14,2933 |
| BRN | 4548207 |
| Stability | Light Sensitive |
| InChI | InChI=1S/C13H13IO8/c1-8(15)19-14(20-9(2)16,21-10(3)17)12-7-5-4-6-11(12)13(18)22-14/h4-7H,1-3H3 |
| InChIKey | NKLCNNUWBJBICK-UHFFFAOYSA-N |
| SMILES | I1(OC(=O)C)(OC(=O)C)(OC(=O)C)OC(=O)C2C=CC=CC1=2 |
| CAS DataBase Reference | 87413-09-0(CAS DataBase Reference) |
| FDA UNII | 336B74JK56 |
| UNSPSC Code | 12352005 |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H272-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P220-P261-P264-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,O,Xi | |||||||||
| Risk Statements | 22-36/37/38-40-8-20/21/22-44 | |||||||||
| Safety Statements | 26-36-36/37-24/25-23-17-45-36/37/39 | |||||||||
| RIDADR | UN 1593 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Harmful/Light sensitive | |||||||||
| TSCA | No | |||||||||
| HazardClass | 5.1 | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 29349990 | |||||||||
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials | |||||||||
| Hazard Classifications | Eye Irrit. 2 Self-react. C Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
