
61717-82-6
| Name | 2-Iodoxybenzoic acid |
| CAS | 61717-82-6 |
| EINECS(EC#) | 629-407-7 |
| Molecular Formula | C7H5IO4 |
| MDL Number | MFCD02912492 |
| Molecular Weight | 280.02 |
| MOL File | 61717-82-6.mol |
Chemical Properties
| Appearance | White to off-white powder, prills or agglomerates |
| Melting point | 280 °C |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Very Slightly, Heated) |
| form | powder to crystal |
| color | White to Almost white |
| Detection Methods | HPLC |
| Merck | 14,5048 |
| InChI | InChI=1S/C7H5IO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10) |
| InChIKey | CQMJEZQEVXQEJB-UHFFFAOYSA-N |
| SMILES | C1(C(=O)O)C=CC=CC=1I(=O)=O |
| CAS DataBase Reference | 61717-82-6(CAS DataBase Reference) |
| Storage Precautions | Light sensitive |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H335-H372 |
| Precautionary statements | P260-P270-P280-P303+P361+P353-P305+P351+P338-P314 |
| Hazard Codes | C,Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 29163990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1 STOT RE 1 Inhalation STOT SE 3 |


