
80844-07-1
| Name | Ethofenprox |
| CAS | 80844-07-1 |
| EINECS(EC#) | 407-980-2 |
| Molecular Formula | C25H28O3 |
| MDL Number | MFCD00210287 |
| Molecular Weight | 376.49 |
| MOL File | 80844-07-1.mol |
Chemical Properties
| Appearance | solid |
| Melting point | 36.4-38.0° |
| Boiling point | 445.03°C (rough estimate) |
| density | 1.1386 (rough estimate) |
| vapor pressure | 32×10-3 Pa (100 °C) |
| refractive index | nD20.2 1.5732 |
| storage temp. | 0-6°C |
| solubility | DMSO: 100 mg/mL (265.61 mM) |
| form | neat |
| Water Solubility | <0.001 mg l-1(25 °C) |
| color | Off-white to light yellow |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Henry's Law Constant | 7.4×101 mol/(m3Pa) at 25℃, Maniere et al. (2011) |
| Major Application | agriculture environmental |
| InChI | 1S/C25H28O3/c1-4-27-22-15-13-21(14-16-22)25(2,3)19-26-18-20-9-8-12-24(17-20)28-23-10-6-5-7-11-23/h5-17H,4,18-19H2,1-3H3 |
| InChIKey | YREQHYQNNWYQCJ-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(cc1)C(C)(C)COCc2cccc(Oc3ccccc3)c2 |
| CAS DataBase Reference | 80844-07-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Etofenprox(80844-07-1) |
Safety Data
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H362-H410 |
| Precautionary statements | P201-P260-P263-P273-P308+P313-P391 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| RTECS | DA0670000 |
| REACH Registrations | Inactive |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Lact. |
| Toxicity |
