5271-27-2
| Name | 1-Methyl-3-phenylpiperazine |
| CAS | 5271-27-2 |
| EINECS(EC#) | 432-360-3 |
| Molecular Formula | C11H16N2 |
| MDL Number | MFCD03411603 |
| Molecular Weight | 176.26 |
| MOL File | 5271-27-2.mol |
Chemical Properties
| Appearance | Off-White Solid |
| Melting point | 56-60 °C (lit.) |
| Boiling point | 85 °C |
| density | 0.991±0.06 g/cm3(Predicted) |
| Fp | 85°C/0.5mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Needles or Crystals |
| pka | 8.52±0.40(Predicted) |
| color | Pale yellow |
| Water Solubility | soluble |
| Sensitive | Air Sensitive |
| Usage | Piperazine derivative used as reference materials for forensic laboratories. They affect the central and the autonomic nervous systems, the blood pressure, and smooth muscle. |
| InChI | InChI=1S/C11H16N2/c1-13-8-7-12-11(9-13)10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3 |
| InChIKey | IRMBVBDXXYXPEW-UHFFFAOYSA-N |
| SMILES | N1(C)CCNC(C2=CC=CC=C2)C1 |
| CAS DataBase Reference | 5271-27-2(CAS DataBase Reference) |
| Storage Precautions | Air sensitive |
Safety Data
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H314 |
| Precautionary statements | P260-P280-P301+P310+P330-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2923 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Inactive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Skin Corr. 1B |