
32247-96-4
| Name | 3,5-Bis(trifluoromethyl)benzyl bromide |
| CAS | 32247-96-4 |
| EINECS(EC#) | 250-971-1 |
| Molecular Formula | C9H5BrF6 |
| MDL Number | MFCD00009905 |
| Molecular Weight | 307.03 |
| MOL File | 32247-96-4.mol |
Chemical Properties
| Appearance | light yellow liquid |
| Melting point | 18°C |
| Boiling point | 136-140°C 14mm |
| density | 1.675 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 79 °F |
| storage temp. | Flammables area |
| solubility | Difficult to mix. |
| form | Liquid |
| color | Clear colorless to yellow-brown |
| Specific Gravity | 1.675 |
| Sensitive | Lachrymatory |
| BRN | 656506 |
| InChI | InChI=1S/C9H5BrF6/c10-4-5-1-6(8(11,12)13)3-7(2-5)9(14,15)16/h1-3H,4H2 |
| InChIKey | ATLQGZVLWOURFU-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 32247-96-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)benzyl bromide(32247-96-4) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |


