328-70-1
| Name | 3,5-Bis(trifluoromethyl)bromobenzene |
| CAS | 328-70-1 |
| EINECS(EC#) | 206-334-5 |
| Molecular Formula | C8H3BrF6 |
| MDL Number | MFCD00000381 |
| Molecular Weight | 293 |
| MOL File | 328-70-1.mol |
Chemical Properties
| Appearance | clear colourless to slightly yellow liquid |
| Melting point | −16 °C(lit.) |
| Boiling point | 154 °C(lit.) |
| density | 1.699 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Sparingly) |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Specific Gravity | 1.699 |
| Water Solubility | Immiscible with water. |
| Detection Methods | GC,NMR |
| BRN | 2123669 |
| InChI | 1S/C8H3BrF6/c9-6-2-4(7(10,11)12)1-5(3-6)8(13,14)15/h1-3H |
| InChIKey | CSVCVIHEBDJTCJ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(Br)cc(c1)C(F)(F)F |
| CAS DataBase Reference | 328-70-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)bromobenzene(328-70-1) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29036990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
