402-31-3
| Name | 1,3-Bis(trifluoromethyl)-benzene |
| CAS | 402-31-3 |
| EINECS(EC#) | 206-939-4 |
| Molecular Formula | C8H4F6 |
| MDL Number | MFCD00000392 |
| Molecular Weight | 214.11 |
| MOL File | 402-31-3.mol |
Chemical Properties
| Appearance | CLEAR COLOURLESS LIQUID |
| Melting point | -35°C |
| Boiling point | 116-116.3 °C(lit.) |
| density | 1.378 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 26 °C |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.378 |
| Water Solubility | Insoluble in water. Soluble in alcohol, ether, benzene. |
| BRN | 2052589 |
| Dielectric constant | 5.9800000000000004 |
| InChI | 1S/C8H4F6/c9-7(10,11)5-2-1-3-6(4-5)8(12,13)14/h1-4H |
| InChIKey | SJBBXFLOLUTGCW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(c1)C(F)(F)F |
| LogP | 3.83 |
| CAS DataBase Reference | 402-31-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,3-bis(trifluoromethyl)-(402-31-3) |
Safety Data
| Symbol(GHS) |    GHS02,GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335-H411 |
| Precautionary statements | P210-P233-P240-P273-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| TSCA | T |
| REACH Registrations | Inactive |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |