
1642-81-5
| Name | 4-(Chloromethyl)benzoic acid |
| CAS | 1642-81-5 |
| EINECS(EC#) | 216-697-1 |
| Molecular Formula | C8H7ClO2 |
| MDL Number | MFCD00002568 |
| Molecular Weight | 170.59 |
| MOL File | 1642-81-5.mol |
Chemical Properties
| Appearance | White to slightly yellow crystalline powder |
| Melting point | 201-202 °C(lit.) |
| Boiling point | 201-203 °C |
| density | 1.315±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 4.11±0.10(Predicted) |
| color | White to slightly yellow |
| Sensitive | Moisture Sensitive |
| BRN | 1907970 |
| InChI | InChI=1S/C8H7ClO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | OITNBJHJJGMFBN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(CCl)C=C1 |
| CAS DataBase Reference | 1642-81-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(Chloromethyl)benzoic acid(1642-81-5) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H334 |
| Precautionary statements | P260-P280-P284-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Resp. Sens. 1 Skin Corr. 1B |

