
5437-38-7
| Name | 3-Methyl-2-nitrobenzoic acid |
| CAS | 5437-38-7 |
| EINECS(EC#) | 226-610-9 |
| Molecular Formula | C8H7NO4 |
| MDL Number | MFCD00007180 |
| Molecular Weight | 181.15 |
| MOL File | 5437-38-7.mol |
Chemical Properties
| Appearance | white to slightly yellow crystalline powder |
| Melting point | 220-223 °C (lit.) |
| Boiling point | 314.24°C (rough estimate) |
| density | 1.4283 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.26±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | <0.1 g/100 mL at 22 ºC |
| BRN | 1960698 |
| InChI | InChI=1S/C8H7NO4/c1-5-3-2-4-6(8(10)11)7(5)9(12)13/h2-4H,1H3,(H,10,11) |
| InChIKey | DGDAVTPQCQXLGU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(C)=C1[N+]([O-])=O |
| CAS DataBase Reference | 5437-38-7(CAS DataBase Reference) |
| EPA Substance Registry System | 5437-38-7(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
