56-91-7
| Name | 4-(Aminomethyl)benzoic acid |
| CAS | 56-91-7 |
| EINECS(EC#) | 200-297-9 |
| Molecular Formula | C8H9NO2 |
| MDL Number | MFCD00010203 |
| Molecular Weight | 151.16 |
| MOL File | 56-91-7.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | ≥300 °C (lit.) |
| Boiling point | 273.17°C (rough estimate) |
| density | 1.2023 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| storage temp. | Store at 0-5°C |
| solubility | Aqueous Base (Slightly), Water (Slightly, Heated, Sonicated) |
| form | Powder |
| pka | 3.75±0.10(Predicted) |
| color | White to almost white |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | Slightly soluble in water. Insoluble in ethanol, benzene and chloroform. |
| BRN | 1100606 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H9NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5,9H2,(H,10,11) |
| InChIKey | QCTBMLYLENLHLA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(CN)C=C1 |
| CAS DataBase Reference | 56-91-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29224900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
