1H-Indole-7-carboxylic acid
- Product Name1H-Indole-7-carboxylic acid
- CAS1670-83-3
- MFC9H7NO2
- MW161.16
- EINECS216-801-5
- MOL File1670-83-3.mol
Chemical Properties
| Melting point | 202 °C |
| Boiling point | 419.6±18.0 °C(Predicted) |
| Density | 1.408±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.55±0.10(Predicted) |
| color | White to Gray to Brown |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C9H7NO2/c11-9(12)7-3-1-2-6-4-5-10-8(6)7/h1-5,10H,(H,11,12) |
| InChIKey | IPDOBVFESNNYEE-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2C(O)=O)C=C1 |
| CAS DataBase Reference | 1670-83-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Indole-7-carboxylic acid (1670-83-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
