2-Bromo-4-fluorobenzonitrile
- Product Name2-Bromo-4-fluorobenzonitrile
- CAS36282-26-5
- MFC7H3BrFN
- MW200.01
- EINECS252-949-7
- MOL File36282-26-5.mol
Chemical Properties
| Melting point | 77-78°C |
| Boiling point | 262.4±25.0 °C(Predicted) |
| Density | 1.69±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Gray to Brown |
| BRN | 1940597 |
| InChI | InChI=1S/C7H3BrFN/c8-7-3-6(9)2-1-5(7)4-10/h1-3H |
| InChIKey | MNNDREXLRLDWEY-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(F)C=C1Br |
| CAS DataBase Reference | 36282-26-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-36/37/39-36/37-26-9 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |